C27H22N4O2S2 — CID 5137670
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 5137670) has the molecular formula C27H22N4O2S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5137670 |
| Molecular Formula | C27H22N4O2S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)C=Cc3cn(-c4ccccc4)nc3-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C27H22N4O2S2/c1-19-9-12-21(13-10-19)28-27-29-22(18-35-27)17-33-25(32)14-11-20-16-31(23-6-3-2-4-7-23)30-26(20)24-8-5-15-34-24/h2-16,18H,17H2,1H3,(H,28,29) |
| InChIKey | GMFWSVRVTORPCB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|