C21H17N3O2S2 — CID 42352164
1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)sulfonyl-2,3-dihydroindole (PubChem CID 42352164) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 42352164 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1cn(-c2ccccc2)nc1-c1cccs1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H17N3O2S2/c25-28(26,24-13-12-16-7-4-5-10-18(16)24)20-15-23(17-8-2-1-3-9-17)22-21(20)19-11-6-14-27-19/h1-11,14-15H,12-13H2 |
| InChIKey | HVPKNEXAZUHBSX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |