C28H25N3O2S2 — CID 42351837
N-benzyl-1-phenyl-N-(2-phenylethyl)-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42351837) has the molecular formula C28H25N3O2S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-benzyl-1-phenyl-N-(2-phenylethyl)-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-benzyl-1-phenyl-N-(2-phenylethyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42351837 |
| Molecular Formula | C28H25N3O2S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-benzyl-1-phenyl-N-(2-phenylethyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(c1cn(-c2ccccc2)nc1-c1cccs1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H25N3O2S2/c32-35(33,30(21-24-13-6-2-7-14-24)19-18-23-11-4-1-5-12-23)27-22-31(25-15-8-3-9-16-25)29-28(27)26-17-10-20-34-26/h1-17,20,22H,18-19,21H2 |
| InChIKey | ACCGXVTVTAMTOQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |