C21H19N3O2S2 — CID 42349835
N-benzyl-1-methyl-N-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349835) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-benzyl-1-methyl-N-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-benzyl-1-methyl-N-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349835 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-benzyl-1-methyl-N-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-23-16-20(21(22-23)19-13-8-14-27-19)28(25,26)24(18-11-6-3-7-12-18)15-17-9-4-2-5-10-17/h2-14,16H,15H2,1H3 |
| InChIKey | IWPCXPPRLVKHEJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |