C13H19N3O2S2 — CID 42349704
1-methyl-N-(3-methylbutyl)-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349704) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-methyl-N-(3-methylbutyl)-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(3-methylbutyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349704 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-methyl-N-(3-methylbutyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)CCNS(=O)(=O)c1cn(C)nc1-c1cccs1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-10(2)6-7-14-20(17,18)12-9-16(3)15-13(12)11-5-4-8-19-11/h4-5,8-10,14H,6-7H2,1-3H3 |
| InChIKey | MJMXJSTWTAZQHV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |