C12H17N3O2S2 — CID 42349702
N-tert-butyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349702) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-tert-butyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-tert-butyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349702 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-tert-butyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC(C)(C)C)c(-c2cccs2)n1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-12(2,3)14-19(16,17)10-8-15(4)13-11(10)9-6-5-7-18-9/h5-8,14H,1-4H3 |
| InChIKey | XLAOSTWNTKINPG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |