C14H19N3O2S2 — CID 42349762
N-cyclohexyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349762) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-cyclohexyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-cyclohexyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349762 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-cyclohexyl-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCCC2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-17-10-13(14(15-17)12-8-5-9-20-12)21(18,19)16-11-6-3-2-4-7-11/h5,8-11,16H,2-4,6-7H2,1H3 |
| InChIKey | MCEWNWMVUIIEHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |