C13H13N3O3S2 — CID 42349802
N-(furan-2-ylmethyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349802) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349802 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCc2ccco2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-16-9-12(13(15-16)11-5-3-7-20-11)21(17,18)14-8-10-4-2-6-19-10/h2-7,9,14H,8H2,1H3 |
| InChIKey | OHMYPHGNLFESQA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |