C14H12ClN3O3S2 — CID 42349956
N-(5-chloro-2-hydroxyphenyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42349956) has the molecular formula C14H12ClN3O3S2 and a molecular weight of 369.86 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349956 |
| Molecular Formula | C14H12ClN3O3S2 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-methyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2cc(Cl)ccc2O)c(-c2cccs2)n1 |
| InChI | InChI=1S/C14H12ClN3O3S2/c1-18-8-13(14(16-18)12-3-2-6-22-12)23(20,21)17-10-7-9(15)4-5-11(10)19/h2-8,17,19H,1H3 |
| InChIKey | FXUSDTNOQAYYPW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|