C27H29N3O2S2 — CID 42350976
1-cyclopentyl-N-(3,3-diphenylpropyl)-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42350976) has the molecular formula C27H29N3O2S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42350976 |
| Molecular Formula | C27H29N3O2S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCC(c1ccccc1)c1ccccc1)c1cn(C2CCCC2)nc1-c1cccs1 |
| InChI | InChI=1S/C27H29N3O2S2/c31-34(32,26-20-30(23-14-7-8-15-23)29-27(26)25-16-9-19-33-25)28-18-17-24(21-10-3-1-4-11-21)22-12-5-2-6-13-22/h1-6,9-13,16,19-20,23-24,28H,7-8,14-15,17-18H2 |
| InChIKey | LLAIXVOYJQKDKP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |