C19H20FN3O2S2 — CID 42351136
1-cyclopentyl-N-(3-fluoro-4-methylphenyl)-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42351136) has the molecular formula C19H20FN3O2S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3-fluoro-4-methylphenyl)-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | 1-cyclopentyl-N-(3-fluoro-4-methylphenyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42351136 |
| Molecular Formula | C19H20FN3O2S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-cyclopentyl-N-(3-fluoro-4-methylphenyl)-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cn(C3CCCC3)nc2-c2cccs2)cc1F |
| InChI | InChI=1S/C19H20FN3O2S2/c1-13-8-9-14(11-16(13)20)22-27(24,25)18-12-23(15-5-2-3-6-15)21-19(18)17-7-4-10-26-17/h4,7-12,15,22H,2-3,5-6H2,1H3 |
| InChIKey | FXWYTMYFMAJMGH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |