C17H19N3O3S2 — CID 42351821
N-ethyl-N-(2-hydroxyethyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42351821) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42351821 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-2-19(10-11-21)25(22,23)16-13-20(14-7-4-3-5-8-14)18-17(16)15-9-6-12-24-15/h3-9,12-13,21H,2,10-11H2,1H3 |
| InChIKey | CYLMBSZWIOEGAZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |