C22H19N3OS — CID 2308237
N-ethyl-N,1-diphenyl-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 2308237) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is N-ethyl-N,1-diphenyl-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-ethyl-N,1-diphenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2308237 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-ethyl-N,1-diphenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2ccccc2)nc1-c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3OS/c1-2-24(17-10-5-3-6-11-17)22(26)19-16-25(18-12-7-4-8-13-18)23-21(19)20-14-9-15-27-20/h3-16H,2H2,1H3 |
| InChIKey | XPAYCIZTBUSTHD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |