C25H22N3O3S- — CID 2121570
4-[benzyl-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]amino]-4-oxobutanoate (PubChem CID 2121570) has the molecular formula C25H22N3O3S- and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[benzyl-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]amino]-4-oxobutanoate.
| Compound Name | 4-[benzyl-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 2121570 |
| Molecular Formula | C25H22N3O3S- |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-[benzyl-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]amino]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)N(Cc1ccccc1)Cc1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C25H23N3O3S/c29-23(13-14-24(30)31)27(16-19-8-3-1-4-9-19)17-20-18-28(21-10-5-2-6-11-21)26-25(20)22-12-7-15-32-22/h1-12,15,18H,13-14,16-17H2,(H,30,31)/p-1 |
| InChIKey | CAJZLKKHVFKGMV-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |