C19H13F2N3O2S2 — CID 42352236
N-(2,5-difluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42352236) has the molecular formula C19H13F2N3O2S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42352236 |
| Molecular Formula | C19H13F2N3O2S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-(2,5-difluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1F)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C19H13F2N3O2S2/c20-13-8-9-15(21)16(11-13)23-28(25,26)18-12-24(14-5-2-1-3-6-14)22-19(18)17-7-4-10-27-17/h1-12,23H |
| InChIKey | BVVQGRJASWWKLK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |