C21H23N3 — CID 7612711
(Z)-1-(1-methyl-2-phenylindol-3-yl)-N-piperidin-1-ylmethanimine (PubChem CID 7612711) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is (Z)-1-(1-methyl-2-phenylindol-3-yl)-N-piperidin-1-ylmethanimine.
| Compound Name | (Z)-1-(1-methyl-2-phenylindol-3-yl)-N-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 7612711 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (Z)-1-(1-methyl-2-phenylindol-3-yl)-N-piperidin-1-ylmethanimine |
| SMILES | Cn1c(-c2ccccc2)c(/C=N\N2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C21H23N3/c1-23-20-13-7-6-12-18(20)19(16-22-24-14-8-3-9-15-24)21(23)17-10-4-2-5-11-17/h2,4-7,10-13,16H,3,8-9,14-15H2,1H3/b22-16- |
| InChIKey | BZYKXRCOCVJZKZ-JWGURIENSA-N |
| XLogP | 4.67 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|