C29H22ClN3 — CID 96877901
N-[(E)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]aniline (PubChem CID 96877901) has the molecular formula C29H22ClN3 and a molecular weight of 447.97 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]aniline.
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 96877901 |
| Molecular Formula | C29H22ClN3 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]aniline |
| SMILES | Clc1ccc(-n2c(-c3ccccc3)cc(/C=N/Nc3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22ClN3/c30-25-16-18-27(19-17-25)33-28(22-10-4-1-5-11-22)20-24(29(33)23-12-6-2-7-13-23)21-31-32-26-14-8-3-9-15-26/h1-21,32H/b31-21+ |
| InChIKey | MWKXJYUWUBGBNQ-NJZRLIGZSA-N |
| XLogP | 7.91 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|