C33H24ClN3O — CID 94844520
(Z)-N-benzyl-3-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyanoprop-2-enamide (PubChem CID 94844520) has the molecular formula C33H24ClN3O and a molecular weight of 514.03 g/mol. Its IUPAC name is (Z)-N-benzyl-3-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-benzyl-3-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 94844520 |
| Molecular Formula | C33H24ClN3O |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (Z)-N-benzyl-3-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cc(-c2ccccc2)n(-c2ccc(Cl)cc2)c1-c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H24ClN3O/c34-29-16-18-30(19-17-29)37-31(25-12-6-2-7-13-25)21-27(32(37)26-14-8-3-9-15-26)20-28(22-35)33(38)36-23-24-10-4-1-5-11-24/h1-21H,23H2,(H,36,38)/b28-20- |
| InChIKey | KHCIHGYNILJKMU-RRAHZORUSA-N |
| XLogP | 7.69 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|