C34H26BrN3O2 — CID 51342257
(E)-3-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyano-N-(3-ethoxyphenyl)prop-2-enamide (PubChem CID 51342257) has the molecular formula C34H26BrN3O2 and a molecular weight of 588.51 g/mol. Its IUPAC name is (E)-3-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyano-N-(3-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyano-N-(3-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51342257 |
| Molecular Formula | C34H26BrN3O2 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | (E)-3-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-2-cyano-N-(3-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cccc(NC(=O)/C(C#N)=C/c2cc(-c3ccccc3)n(-c3ccc(Br)cc3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C34H26BrN3O2/c1-2-40-31-15-9-14-29(22-31)37-34(39)27(23-36)20-26-21-32(24-10-5-3-6-11-24)38(30-18-16-28(35)17-19-30)33(26)25-12-7-4-8-13-25/h3-22H,2H2,1H3,(H,37,39)/b27-20+ |
| InChIKey | ZFNFUWNSUKIYHE-NHFJDJAPSA-N |
| XLogP | 8.52 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|