C36H29N3O3 — CID 124534435
ethyl 4-[3-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2,5-diphenylpyrrol-1-yl]benzoate (PubChem CID 124534435) has the molecular formula C36H29N3O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2,5-diphenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2,5-diphenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 124534435 |
| Molecular Formula | C36H29N3O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | ethyl 4-[3-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2,5-diphenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(/C=C(\C#N)C(=O)Nc3ccc(C)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H29N3O3/c1-3-42-36(41)28-16-20-32(21-17-28)39-33(26-10-6-4-7-11-26)23-29(34(39)27-12-8-5-9-13-27)22-30(24-37)35(40)38-31-18-14-25(2)15-19-31/h4-23H,3H2,1-2H3,(H,38,40)/b30-22+ |
| InChIKey | PTSLQYWFOHNWLO-JBASAIQMSA-N |
| XLogP | 7.84 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|