C13H14F2NS+ — CID 69187648
3-[(2,4-difluorophenyl)methyl]-2,4,5-trimethyl-1,3-thiazol-3-ium (PubChem CID 69187648) has the molecular formula C13H14F2NS+ and a molecular weight of 254.32 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-2,4,5-trimethyl-1,3-thiazol-3-ium.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-2,4,5-trimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 69187648 |
| Molecular Formula | C13H14F2NS+ |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-2,4,5-trimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1sc(C)[n+](Cc2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C13H14F2NS/c1-8-9(2)17-10(3)16(8)7-11-4-5-12(14)6-13(11)15/h4-6H,7H2,1-3H3/q+1 |
| InChIKey | JFLLHGMKMFNCLB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|