C14H14F2OS — CID 114910631
1-(2,4-difluorophenyl)-2-(5-methylthiophen-2-yl)propan-2-ol (PubChem CID 114910631) has the molecular formula C14H14F2OS and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(5-methylthiophen-2-yl)propan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(5-methylthiophen-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 114910631 |
| Molecular Formula | C14H14F2OS |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(5-methylthiophen-2-yl)propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C14H14F2OS/c1-9-3-6-13(18-9)14(2,17)8-10-4-5-11(15)7-12(10)16/h3-7,17H,8H2,1-2H3 |
| InChIKey | DYSCBZUUGJVLJE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |