C12H11F2N — CID 90396848
4-[(2,4-difluorophenyl)methyl]-2-methyl-1H-pyrrole (PubChem CID 90396848) has the molecular formula C12H11F2N and a molecular weight of 207.22 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-2-methyl-1H-pyrrole.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-2-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 90396848 |
| Molecular Formula | C12H11F2N |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-2-methyl-1H-pyrrole |
| SMILES | Cc1cc(Cc2ccc(F)cc2F)c[nH]1 |
| InChI | InChI=1S/C12H11F2N/c1-8-4-9(7-15-8)5-10-2-3-11(13)6-12(10)14/h2-4,6-7,15H,5H2,1H3 |
| InChIKey | JHMQSDBAVYBUDQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |