C13H11F2NO2 — CID 57435155
4-[2-(2,4-difluorophenyl)ethyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 57435155) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)ethyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[2-(2,4-difluorophenyl)ethyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 57435155 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)ethyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(CCc2ccc(F)cc2F)c[nH]1 |
| InChI | InChI=1S/C13H11F2NO2/c14-10-4-3-9(11(15)6-10)2-1-8-5-12(13(17)18)16-7-8/h3-7,16H,1-2H2,(H,17,18) |
| InChIKey | VKMBPVRKPJPIHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |