C13H13F2N — CID 19986378
1-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrole (PubChem CID 19986378) has the molecular formula C13H13F2N and a molecular weight of 221.25 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrole.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 19986378 |
| Molecular Formula | C13H13F2N |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2N/c1-9-3-4-10(2)16(9)8-11-5-6-12(14)7-13(11)15/h3-7H,8H2,1-2H3 |
| InChIKey | PNSQYNVFXRVIAK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |