C11H10F2N2 — CID 130254978
1-[(2,4-difluorophenyl)methyl]-4-methylimidazole (PubChem CID 130254978) has the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-methylimidazole.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-methylimidazole |
|---|---|
| PubChem CID | 130254978 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-methylimidazole |
| SMILES | Cc1cn(Cc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C11H10F2N2/c1-8-5-15(7-14-8)6-9-2-3-10(12)4-11(9)13/h2-5,7H,6H2,1H3 |
| InChIKey | LBHPTLXEEQSZCO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |