C12H9F2IN2O2 — CID 79785335
3-[(2,4-difluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione (PubChem CID 79785335) has the molecular formula C12H9F2IN2O2 and a molecular weight of 378.12 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79785335 |
| Molecular Formula | C12H9F2IN2O2 |
| Molecular Weight | 378.12 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(I)c(=O)n(Cc2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C12H9F2IN2O2/c1-16-6-10(15)11(18)17(12(16)19)5-7-2-3-8(13)4-9(7)14/h2-4,6H,5H2,1H3 |
| InChIKey | UXDWLCJDBYEPEA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|