C11H9F2N2+ — CID 139736917
1-[(2,4-difluorophenyl)methyl]pyrazin-1-ium (PubChem CID 139736917) has the molecular formula C11H9F2N2+ and a molecular weight of 207.20 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]pyrazin-1-ium.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]pyrazin-1-ium |
|---|---|
| PubChem CID | 139736917 |
| Molecular Formula | C11H9F2N2+ |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]pyrazin-1-ium |
| SMILES | Fc1ccc(C[n+]2ccncc2)c(F)c1 |
| InChI | InChI=1S/C11H9F2N2/c12-10-2-1-9(11(13)7-10)8-15-5-3-14-4-6-15/h1-7H,8H2/q+1 |
| InChIKey | KQJFGPJGGZSVDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|