C27H22F6N6O+2 — CID 54771600
2-(2,4-difluorophenyl)-1,3-bis[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]propan-2-ol (PubChem CID 54771600) has the molecular formula C27H22F6N6O+2 and a molecular weight of 560.50 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3-bis[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,3-bis[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 54771600 |
| Molecular Formula | C27H22F6N6O+2 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3-bis[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]propan-2-ol |
| SMILES | OC(Cn1c[n+](Cc2ccc(F)cc2F)cn1)(Cn1c[n+](Cc2ccc(F)cc2F)cn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H22F6N6O/c28-20-3-1-18(24(31)7-20)10-36-14-34-38(16-36)12-27(40,23-6-5-22(30)9-26(23)33)13-39-17-37(15-35-39)11-19-2-4-21(29)8-25(19)32/h1-9,14-17,40H,10-13H2/q+2 |
| InChIKey | YDMXCBJIMAARLE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|