C27H24Cl4F2N6O — CID 54771605
1,3-bis[4-[(3-chlorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-2-(2,4-difluorophenyl)propan-2-ol dichloride (PubChem CID 54771605) has the molecular formula C27H24Cl4F2N6O and a molecular weight of 628.34 g/mol. Its IUPAC name is 1,3-bis[4-[(3-chlorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-2-(2,4-difluorophenyl)propan-2-ol dichloride.
| Compound Name | 1,3-bis[4-[(3-chlorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-2-(2,4-difluorophenyl)propan-2-ol dichloride |
|---|---|
| PubChem CID | 54771605 |
| Molecular Formula | C27H24Cl4F2N6O |
| Molecular Weight | 628.34 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | 1,3-bis[4-[(3-chlorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-2-(2,4-difluorophenyl)propan-2-ol dichloride |
| SMILES | OC(Cn1c[n+](Cc2cccc(Cl)c2)cn1)(Cn1c[n+](Cc2cccc(Cl)c2)cn1)c1ccc(F)cc1F.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H24Cl2F2N6O.2ClH/c28-22-5-1-3-20(9-22)12-34-16-32-36(18-34)14-27(38,25-8-7-24(30)11-26(25)31)15-37-19-35(17-33-37)13-21-4-2-6-23(29)10-21;;/h1-11,16-19,38H,12-15H2;2*1H/q+2;;/p-2 |
| InChIKey | VFVRURZGNGKSAD-UHFFFAOYSA-L |
| XLogP | -2.07 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.34 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|