C14H17F2N7O4S — CID 11133512
1-(4-amino-1,2,4-triazol-4-ium-1-yl)-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol;methanesulfonate (PubChem CID 11133512) has the molecular formula C14H17F2N7O4S and a molecular weight of 417.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,4-triazol-4-ium-1-yl)-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol;methanesulfonate.
| Compound Name | 1-(4-amino-1,2,4-triazol-4-ium-1-yl)-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol;methanesulfonate |
|---|---|
| PubChem CID | 11133512 |
| Molecular Formula | C14H17F2N7O4S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-(4-amino-1,2,4-triazol-4-ium-1-yl)-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].N[n+]1cnn(CC(O)(Cn2cncn2)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H14F2N7O.CH4O3S/c14-10-1-2-11(12(15)3-10)13(23,4-21-7-17-6-18-21)5-22-9-20(16)8-19-22;1-5(2,3)4/h1-3,6-9,23H,4-5,16H2;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | PYXYXJMIXXDPPS-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|