C17H18F3N5O5P+ — CID 153297648
[1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]methyl dihydrogen phosphate (PubChem CID 153297648) has the molecular formula C17H18F3N5O5P+ and a molecular weight of 460.33 g/mol. Its IUPAC name is [1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 153297648 |
| Molecular Formula | C17H18F3N5O5P+ |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]methyl dihydrogen phosphate |
| SMILES | C[C@@H](c1ncncc1F)[C@](O)(Cn1c[n+](COP(=O)(O)O)cn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F3N5O5P/c1-11(16-15(20)5-21-7-22-16)17(26,13-3-2-12(18)4-14(13)19)6-25-9-24(8-23-25)10-30-31(27,28)29/h2-5,7-9,11,26H,6,10H2,1H3,(H-,27,28,29)/p+1/t11-,17+/m0/s1 |
| InChIKey | BMFJQPAOUWHWTJ-APPDUMDISA-O |
| XLogP | 1.14 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|