C16H16F3N5O5S — CID 66546620
(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;sulfuric acid (PubChem CID 66546620) has the molecular formula C16H16F3N5O5S and a molecular weight of 447.40 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;sulfuric acid.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;sulfuric acid |
|---|---|
| PubChem CID | 66546620 |
| Molecular Formula | C16H16F3N5O5S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;sulfuric acid |
| SMILES | C[C@@H](c1ncncc1F)[C@](O)(Cn1cncn1)c1ccc(F)cc1F.O=S(=O)(O)O |
| InChI | InChI=1S/C16H14F3N5O.H2O4S/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18;1-5(2,3)4/h2-5,7-10,25H,6H2,1H3;(H2,1,2,3,4)/t10-,16+;/m0./s1 |
| InChIKey | WDAPJOPHUQSXLM-XVQZZTKGSA-N |
| XLogP | 1.52 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|