C16H17F3N5O5P — CID 75220054
2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;phosphoric acid (PubChem CID 75220054) has the molecular formula C16H17F3N5O5P and a molecular weight of 447.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;phosphoric acid.
| Compound Name | 2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;phosphoric acid |
|---|---|
| PubChem CID | 75220054 |
| Molecular Formula | C16H17F3N5O5P |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol;phosphoric acid |
| SMILES | CC(c1ncncc1F)C(O)(Cn1cncn1)c1ccc(F)cc1F.O=P(O)(O)O |
| InChI | InChI=1S/C16H14F3N5O.H3O4P/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18;1-5(2,3)4/h2-5,7-10,25H,6H2,1H3;(H3,1,2,3,4) |
| InChIKey | YFRKYIMPLTWXDK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|