C12H14F2N3O4P — CID 175171428
[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phosphonic acid (PubChem CID 175171428) has the molecular formula C12H14F2N3O4P and a molecular weight of 333.23 g/mol. Its IUPAC name is [3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phosphonic acid.
| Compound Name | [3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 175171428 |
| Molecular Formula | C12H14F2N3O4P |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phosphonic acid |
| SMILES | CC(C(O)(Cn1cncn1)c1ccc(F)cc1F)P(=O)(O)O |
| InChI | InChI=1S/C12H14F2N3O4P/c1-8(22(19,20)21)12(18,5-17-7-15-6-16-17)10-3-2-9(13)4-11(10)14/h2-4,6-8,18H,5H2,1H3,(H2,19,20,21) |
| InChIKey | BESRJWVHDOQMFD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|