C10H18S — CID 90998829
ethane;2,3,4,5-tetramethylthiophene (PubChem CID 90998829) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is ethane;2,3,4,5-tetramethylthiophene.
| Compound Name | ethane;2,3,4,5-tetramethylthiophene |
|---|---|
| PubChem CID | 90998829 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;2,3,4,5-tetramethylthiophene |
| SMILES | CC.Cc1sc(C)c(C)c1C |
| InChI | InChI=1S/C8H12S.C2H6/c1-5-6(2)8(4)9-7(5)3;1-2/h1-4H3;1-2H3 |
| InChIKey | SQYWQDTZFZCBRV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |