C9H12SSi — CID 173118169
2-(2,4,5-trimethylthiophen-3-yl)ethynylsilane (PubChem CID 173118169) has the molecular formula C9H12SSi and a molecular weight of 180.35 g/mol. Its IUPAC name is 2-(2,4,5-trimethylthiophen-3-yl)ethynylsilane.
| Compound Name | 2-(2,4,5-trimethylthiophen-3-yl)ethynylsilane |
|---|---|
| PubChem CID | 173118169 |
| Molecular Formula | C9H12SSi |
| Molecular Weight | 180.35 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-(2,4,5-trimethylthiophen-3-yl)ethynylsilane |
| SMILES | Cc1sc(C)c(C#C[SiH3])c1C |
| InChI | InChI=1S/C9H12SSi/c1-6-7(2)10-8(3)9(6)4-5-11/h1-3,11H3 |
| InChIKey | IILULLMHHQBJDP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|