C7H11BO2S — CID 57416369
(3,4,5-trimethylthiophen-2-yl)boronic acid (PubChem CID 57416369) has the molecular formula C7H11BO2S and a molecular weight of 170.04 g/mol. Its IUPAC name is (3,4,5-trimethylthiophen-2-yl)boronic acid.
| Compound Name | (3,4,5-trimethylthiophen-2-yl)boronic acid |
|---|---|
| PubChem CID | 57416369 |
| Molecular Formula | C7H11BO2S |
| Molecular Weight | 170.04 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (3,4,5-trimethylthiophen-2-yl)boronic acid |
| SMILES | Cc1sc(B(O)O)c(C)c1C |
| InChI | InChI=1S/C7H11BO2S/c1-4-5(2)7(8(9)10)11-6(4)3/h9-10H,1-3H3 |
| InChIKey | ZQDRMSUWEZWSRS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.04 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|