C13H19NO5S2 — CID 158675750
3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide (PubChem CID 158675750) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide.
| Compound Name | 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide |
|---|---|
| PubChem CID | 158675750 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide |
| SMILES | Cc1cc2sc(C)[n+](CCCOS(=O)(=O)O)c2cc1C.[OH-] |
| InChI | InChI=1S/C13H17NO4S2.H2O/c1-9-7-12-13(8-10(9)2)19-11(3)14(12)5-4-6-18-20(15,16)17;/h7-8H,4-6H2,1-3H3;1H2 |
| InChIKey | UGJITOKQMRHMBO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|