3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide

C13H19NO5S2 — CID 158675750

IUPAC3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide
SMILESCc1cc2sc(C)[n+](CCCOS(=O)(=O)O)c2cc1C.[OH-]
InChIInChI=1S/C13H17NO4S2.H2O/c1-9-7-12-13(8-10(9)2)19-11(3)14(12)5-4-6-18-20(15,16)17;/h7-8H,4-6H2,1-3H3;1H2
InChIKeyUGJITOKQMRHMBO-UHFFFAOYSA-N
MW333.43 g/mol
LogP2.15
Rot. Bonds5

About 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide

3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide (PubChem CID 158675750) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide.

Molecular Properties

Compound Name3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide
PubChem CID158675750
Molecular FormulaC13H19NO5S2
Molecular Weight333.43 g/mol
Exact Mass333.07
IUPAC Name3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide
SMILESCc1cc2sc(C)[n+](CCCOS(=O)(=O)O)c2cc1C.[OH-]
InChIInChI=1S/C13H17NO4S2.H2O/c1-9-7-12-13(8-10(9)2)19-11(3)14(12)5-4-6-18-20(15,16)17;/h7-8H,4-6H2,1-3H3;1H2
InChIKeyUGJITOKQMRHMBO-UHFFFAOYSA-N
XLogP2.15
TPSA97.48 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.43
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide?
The IUPAC name of 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide (CID 158675750) is 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide.
What is the SMILES notation for 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide?
The canonical SMILES for 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide is Cc1cc2sc(C)[n+](CCCOS(=O)(=O)O)c2cc1C.[OH-].
What is the InChIKey of 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide?
The InChIKey is UGJITOKQMRHMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4S2.H2O/c1-9-7-12-13(8-10(9)2)19-11(3)14(12)5-4-6-18-20(15,16)17;/h7-8H,4-6H2,1-3H3;1H2.
What are the key properties of 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide?
3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide has a molecular weight of 333.43 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl hydrogen sulfate hydroxide is sourced from PubChem (CID 158675750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).