C20H26BrF6N2OP — CID 22993268
trimethyl-[3-(2-methyl-5-phenyl-1,3-benzoxazol-3-ium-3-yl)propyl]azanium;bromide;hexafluorophosphate (PubChem CID 22993268) has the molecular formula C20H26BrF6N2OP and a molecular weight of 535.31 g/mol. Its IUPAC name is trimethyl-[3-(2-methyl-5-phenyl-1,3-benzoxazol-3-ium-3-yl)propyl]azanium;bromide;hexafluorophosphate.
| Compound Name | trimethyl-[3-(2-methyl-5-phenyl-1,3-benzoxazol-3-ium-3-yl)propyl]azanium;bromide;hexafluorophosphate |
|---|---|
| PubChem CID | 22993268 |
| Molecular Formula | C20H26BrF6N2OP |
| Molecular Weight | 535.31 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | trimethyl-[3-(2-methyl-5-phenyl-1,3-benzoxazol-3-ium-3-yl)propyl]azanium;bromide;hexafluorophosphate |
| SMILES | Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCC[N+](C)(C)C.F[P-](F)(F)(F)(F)F.[Br-] |
| InChI | InChI=1S/C20H26N2O.BrH.F6P/c1-16-21(13-8-14-22(2,3)4)19-15-18(11-12-20(19)23-16)17-9-6-5-7-10-17;;1-7(2,3,4,5)6/h5-7,9-12,15H,8,13-14H2,1-4H3;1H;/q+2;;-1/p-1 |
| InChIKey | XCBFWSAPEGKYGY-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|