C16H20BrNO3S2 — CID 171152065
2-[1-(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-ylsulfanyl]acetic acid bromide (PubChem CID 171152065) has the molecular formula C16H20BrNO3S2 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[1-(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-ylsulfanyl]acetic acid bromide.
| Compound Name | 2-[1-(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-ylsulfanyl]acetic acid bromide |
|---|---|
| PubChem CID | 171152065 |
| Molecular Formula | C16H20BrNO3S2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-[1-(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-ylsulfanyl]acetic acid bromide |
| SMILES | CCC(=Cc1sc2ccc(OC)cc2[n+]1CC)SCC(=O)O.[Br-] |
| InChI | InChI=1S/C16H19NO3S2.BrH/c1-4-12(21-10-16(18)19)9-15-17(5-2)13-8-11(20-3)6-7-14(13)22-15;/h6-9H,4-5,10H2,1-3H3;1H |
| InChIKey | LRVXAPSBJBPOCU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|