C14H17ClNOS+ — CID 54403868
5-chloro-3-ethyl-2-(2-methoxybut-1-enyl)-1,3-benzothiazol-3-ium (PubChem CID 54403868) has the molecular formula C14H17ClNOS+ and a molecular weight of 282.82 g/mol. Its IUPAC name is 5-chloro-3-ethyl-2-(2-methoxybut-1-enyl)-1,3-benzothiazol-3-ium.
| Compound Name | 5-chloro-3-ethyl-2-(2-methoxybut-1-enyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 54403868 |
| Molecular Formula | C14H17ClNOS+ |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 5-chloro-3-ethyl-2-(2-methoxybut-1-enyl)-1,3-benzothiazol-3-ium |
| SMILES | CCC(=Cc1sc2ccc(Cl)cc2[n+]1CC)OC |
| InChI | InChI=1S/C14H17ClNOS/c1-4-11(17-3)9-14-16(5-2)12-8-10(15)6-7-13(12)18-14/h6-9H,4-5H2,1-3H3/q+1 |
| InChIKey | VPHOGZJGSPUNCG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|