C15H18ClNO4S2 — CID 3109001
3-[5-chloro-2-(2-ethoxyprop-1-enyl)-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 3109001) has the molecular formula C15H18ClNO4S2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 3-[5-chloro-2-(2-ethoxyprop-1-enyl)-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-(2-ethoxyprop-1-enyl)-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 3109001 |
| Molecular Formula | C15H18ClNO4S2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 3-[5-chloro-2-(2-ethoxyprop-1-enyl)-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CCOC(C)=Cc1sc2ccc(Cl)cc2[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H18ClNO4S2/c1-3-21-11(2)9-15-17(7-4-8-23(18,19)20)13-10-12(16)5-6-14(13)22-15/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | ODOAWYMTCLJHMF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|