C25H28Cl2N2O6S4 — CID 135970887
3-[5-chloro-2-[(2E)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 135970887) has the molecular formula C25H28Cl2N2O6S4 and a molecular weight of 651.68 g/mol. Its IUPAC name is 3-[5-chloro-2-[(2E)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[(2E)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 135970887 |
| Molecular Formula | C25H28Cl2N2O6S4 |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 650.02 |
| IUPAC Name | 3-[5-chloro-2-[(2E)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | CC/C(C=C1SC2C=CC(Cl)=CC2N1CCCS(=O)(=O)[O-])=C\c1sc2ccc(Cl)cc2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C25H28Cl2N2O6S4/c1-2-17(13-24-28(9-3-11-38(30,31)32)20-15-18(26)5-7-22(20)36-24)14-25-29(10-4-12-39(33,34)35)21-16-19(27)6-8-23(21)37-25/h5-8,13-16,20,22H,2-4,9-12H2,1H3,(H-,30,31,32,33,34,35) |
| InChIKey | QIROZQAMKBQYNV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|