C25H29Cl2N2O6S4+ — CID 135963020
3-[(2E)-5-chloro-2-[(2Z)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 135963020) has the molecular formula C25H29Cl2N2O6S4+ and a molecular weight of 652.69 g/mol. Its IUPAC name is 3-[(2E)-5-chloro-2-[(2Z)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-5-chloro-2-[(2Z)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 135963020 |
| Molecular Formula | C25H29Cl2N2O6S4+ |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 651.03 |
| IUPAC Name | 3-[(2E)-5-chloro-2-[(2Z)-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-3a,7a-dihydro-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCC(=C/c1sc2ccc(Cl)cc2[n+]1CCCS(=O)(=O)O)/C=C1/SC2C=CC(Cl)=CC2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C25H28Cl2N2O6S4/c1-2-17(13-24-28(9-3-11-38(30,31)32)20-15-18(26)5-7-22(20)36-24)14-25-29(10-4-12-39(33,34)35)21-16-19(27)6-8-23(21)37-25/h5-8,13-16,20,22H,2-4,9-12H2,1H3,(H-,30,31,32,33,34,35)/p+1 |
| InChIKey | QIROZQAMKBQYNV-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|