C22H23ClN3O3S+ — CID 21362086
2-[N-(2-amino-2-oxoethyl)-4-[(E)-2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoic acid (PubChem CID 21362086) has the molecular formula C22H23ClN3O3S+ and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-[N-(2-amino-2-oxoethyl)-4-[(E)-2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoic acid.
| Compound Name | 2-[N-(2-amino-2-oxoethyl)-4-[(E)-2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 21362086 |
| Molecular Formula | C22H23ClN3O3S+ |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[N-(2-amino-2-oxoethyl)-4-[(E)-2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoic acid |
| SMILES | CC[n+]1c(/C=C/c2ccc(N(CC(N)=O)C(C)C(=O)O)cc2)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H22ClN3O3S/c1-3-25-18-12-16(23)7-10-19(18)30-21(25)11-6-15-4-8-17(9-5-15)26(13-20(24)27)14(2)22(28)29/h4-12,14H,3,13H2,1-2H3,(H2-,24,27,28,29)/p+1 |
| InChIKey | FUIBHBAFPMZZMV-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|