C34H37ClN3O9S4+ — CID 91121512
2-[N-(carboxymethyl)-4-[4-[5-chloro-2-[[3-(3-sulfopropyl)-3H-1-benzothiophen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butylsulfamoyl]anilino]propanoic acid (PubChem CID 91121512) has the molecular formula C34H37ClN3O9S4+ and a molecular weight of 795.40 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-4-[4-[5-chloro-2-[[3-(3-sulfopropyl)-3H-1-benzothiophen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butylsulfamoyl]anilino]propanoic acid.
| Compound Name | 2-[N-(carboxymethyl)-4-[4-[5-chloro-2-[[3-(3-sulfopropyl)-3H-1-benzothiophen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butylsulfamoyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 91121512 |
| Molecular Formula | C34H37ClN3O9S4+ |
| Molecular Weight | 795.40 g/mol |
| Exact Mass | 794.11 |
| IUPAC Name | 2-[N-(carboxymethyl)-4-[4-[5-chloro-2-[[3-(3-sulfopropyl)-3H-1-benzothiophen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butylsulfamoyl]anilino]propanoic acid |
| SMILES | CC(C(=O)O)N(CC(=O)O)c1ccc(S(=O)(=O)NCCCC[n+]2c(C=C3Sc4ccccc4C3CCCS(=O)(=O)O)sc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C34H36ClN3O9S4/c1-22(34(41)42)38(21-33(39)40)24-11-13-25(14-12-24)51(46,47)36-16-4-5-17-37-28-19-23(35)10-15-30(28)49-32(37)20-31-27(8-6-18-50(43,44)45)26-7-2-3-9-29(26)48-31/h2-3,7,9-15,19-20,22,27,36H,4-6,8,16-18,21H2,1H3,(H2-,39,40,41,42,43,44,45)/p+1 |
| InChIKey | QYFPCONGVWSMTR-UHFFFAOYSA-O |
| XLogP | 5.86 |
| TPSA | 182.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|