C35H38Cl2N3O3S2+ — CID 59038856
2-[4-[[3-[4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-3H-1-benzothiophen-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butylamino]-3-oxopropyl]-ethylamino]phenyl]acetic acid (PubChem CID 59038856) has the molecular formula C35H38Cl2N3O3S2+ and a molecular weight of 683.75 g/mol. Its IUPAC name is 2-[4-[[3-[4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-3H-1-benzothiophen-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butylamino]-3-oxopropyl]-ethylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-3H-1-benzothiophen-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butylamino]-3-oxopropyl]-ethylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59038856 |
| Molecular Formula | C35H38Cl2N3O3S2+ |
| Molecular Weight | 683.75 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 2-[4-[[3-[4-[5-chloro-2-[(Z)-(5-chloro-3-ethyl-3H-1-benzothiophen-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]butylamino]-3-oxopropyl]-ethylamino]phenyl]acetic acid |
| SMILES | CCC1/C(=C/c2sc3ccc(Cl)cc3[n+]2CCCCNC(=O)CCN(CC)c2ccc(CC(=O)O)cc2)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C35H37Cl2N3O3S2/c1-3-27-28-20-24(36)9-13-30(28)44-32(27)22-34-40(29-21-25(37)10-14-31(29)45-34)17-6-5-16-38-33(41)15-18-39(4-2)26-11-7-23(8-12-26)19-35(42)43/h7-14,20-22,27H,3-6,15-19H2,1-2H3,(H-,38,41,42,43)/p+1/b32-22- |
| InChIKey | QIZGAOZBEQJUFM-JDCMOKTRSA-O |
| XLogP | 8.58 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.75 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|