C22H22ClN3NaO3S+ — CID 59094905
sodium 2-[N-(2-amino-2-oxoethyl)-4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoate (PubChem CID 59094905) has the molecular formula C22H22ClN3NaO3S+ and a molecular weight of 466.95 g/mol. Its IUPAC name is sodium 2-[N-(2-amino-2-oxoethyl)-4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoate.
| Compound Name | sodium 2-[N-(2-amino-2-oxoethyl)-4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoate |
|---|---|
| PubChem CID | 59094905 |
| Molecular Formula | C22H22ClN3NaO3S+ |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | sodium 2-[N-(2-amino-2-oxoethyl)-4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]propanoate |
| SMILES | CC[n+]1c(C=Cc2ccc(N(CC(N)=O)C(C)C(=O)[O-])cc2)sc2ccc(Cl)cc21.[Na+] |
| InChI | InChI=1S/C22H22ClN3O3S.Na/c1-3-25-18-12-16(23)7-10-19(18)30-21(25)11-6-15-4-8-17(9-5-15)26(13-20(24)27)14(2)22(28)29;/h4-12,14H,3,13H2,1-2H3,(H2-,24,27,28,29);/q;+1 |
| InChIKey | HCVQZVBETSHPRO-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|