C23H30ClN2O4SSi+ — CID 54201163
[5-chloro-2-[(E)-2-[4-[ethyl(1-trimethylsilylethyl)amino]phenyl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid (PubChem CID 54201163) has the molecular formula C23H30ClN2O4SSi+ and a molecular weight of 494.11 g/mol. Its IUPAC name is [5-chloro-2-[(E)-2-[4-[ethyl(1-trimethylsilylethyl)amino]phenyl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid.
| Compound Name | [5-chloro-2-[(E)-2-[4-[ethyl(1-trimethylsilylethyl)amino]phenyl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 54201163 |
| Molecular Formula | C23H30ClN2O4SSi+ |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [5-chloro-2-[(E)-2-[4-[ethyl(1-trimethylsilylethyl)amino]phenyl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
| SMILES | CCN(c1ccc(/C=C/c2oc3ccc(Cl)cc3[n+]2CS(=O)(=O)O)cc1)C(C)[Si](C)(C)C |
| InChI | InChI=1S/C23H29ClN2O4SSi/c1-6-25(17(2)32(3,4)5)20-11-7-18(8-12-20)9-14-23-26(16-31(27,28)29)21-15-19(24)10-13-22(21)30-23/h7-15,17H,6,16H2,1-5H3/p+1 |
| InChIKey | PPISCAFLTOYEGG-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|